C14H24N2O3S — CID 43807496
N'-(2-ethylsulfonylethyl)-N'-(4-methoxyphenyl)propane-1,3-diamine (PubChem CID 43807496) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is N'-(2-ethylsulfonylethyl)-N'-(4-methoxyphenyl)propane-1,3-diamine.
| Compound Name | N'-(2-ethylsulfonylethyl)-N'-(4-methoxyphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 43807496 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N'-(2-ethylsulfonylethyl)-N'-(4-methoxyphenyl)propane-1,3-diamine |
| SMILES | CCS(=O)(=O)CCN(CCCN)c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H24N2O3S/c1-3-20(17,18)12-11-16(10-4-9-15)13-5-7-14(19-2)8-6-13/h5-8H,3-4,9-12,15H2,1-2H3 |
| InChIKey | BXFRNKPAPKCJEL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|