C15H20N4O — CID 62698200
N'-(4-methoxyphenyl)-N'-(pyrimidin-2-ylmethyl)propane-1,3-diamine (PubChem CID 62698200) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is N'-(4-methoxyphenyl)-N'-(pyrimidin-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-(4-methoxyphenyl)-N'-(pyrimidin-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62698200 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N'-(4-methoxyphenyl)-N'-(pyrimidin-2-ylmethyl)propane-1,3-diamine |
| SMILES | COc1ccc(N(CCCN)Cc2ncccn2)cc1 |
| InChI | InChI=1S/C15H20N4O/c1-20-14-6-4-13(5-7-14)19(11-2-8-16)12-15-17-9-3-10-18-15/h3-7,9-10H,2,8,11-12,16H2,1H3 |
| InChIKey | ZNTJSSUBDGNUQJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|