C22H24NO4S+ — CID 10692193
4-[4-[4-(4-methoxyphenyl)phenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 10692193) has the molecular formula C22H24NO4S+ and a molecular weight of 398.50 g/mol. Its IUPAC name is 4-[4-[4-(4-methoxyphenyl)phenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[4-[4-(4-methoxyphenyl)phenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 10692193 |
| Molecular Formula | C22H24NO4S+ |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-[4-[4-(4-methoxyphenyl)phenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | COc1ccc(-c2ccc(-c3cc[n+](CCCCS(=O)(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H23NO4S/c1-27-22-10-8-20(9-11-22)18-4-6-19(7-5-18)21-12-15-23(16-13-21)14-2-3-17-28(24,25)26/h4-13,15-16H,2-3,14,17H2,1H3/p+1 |
| InChIKey | OWABNDNXDNHNGC-UHFFFAOYSA-O |
| XLogP | 3.98 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|