C15H20NO4S+ — CID 23642932
4-(6-methoxy-4-methylquinolin-1-ium-1-yl)butane-1-sulfonic acid (PubChem CID 23642932) has the molecular formula C15H20NO4S+ and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-(6-methoxy-4-methylquinolin-1-ium-1-yl)butane-1-sulfonic acid.
| Compound Name | 4-(6-methoxy-4-methylquinolin-1-ium-1-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 23642932 |
| Molecular Formula | C15H20NO4S+ |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-(6-methoxy-4-methylquinolin-1-ium-1-yl)butane-1-sulfonic acid |
| SMILES | COc1ccc2c(c1)c(C)cc[n+]2CCCCS(=O)(=O)O |
| InChI | InChI=1S/C15H19NO4S/c1-12-7-9-16(8-3-4-10-21(17,18)19)15-6-5-13(20-2)11-14(12)15/h5-7,9,11H,3-4,8,10H2,1-2H3/p+1 |
| InChIKey | WFIHLAVYNRZZEF-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|