C24H25N2O4S+ — CID 102139310
3-[2-[2-(5-methoxy-1H-indol-3-yl)ethenyl]-6-methylquinolin-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 102139310) has the molecular formula C24H25N2O4S+ and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-[2-[2-(5-methoxy-1H-indol-3-yl)ethenyl]-6-methylquinolin-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[2-(5-methoxy-1H-indol-3-yl)ethenyl]-6-methylquinolin-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 102139310 |
| Molecular Formula | C24H25N2O4S+ |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 3-[2-[2-(5-methoxy-1H-indol-3-yl)ethenyl]-6-methylquinolin-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | COc1ccc2[nH]cc(C=Cc3ccc4cc(C)ccc4[n+]3CCCS(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C24H24N2O4S/c1-17-4-11-24-18(14-17)5-7-20(26(24)12-3-13-31(27,28)29)8-6-19-16-25-23-10-9-21(30-2)15-22(19)23/h4-11,14-16H,3,12-13H2,1-2H3,(H,27,28,29)/p+1 |
| InChIKey | LIZWDTVACIBEMW-UHFFFAOYSA-O |
| XLogP | 4.37 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|