C25H24N2O5S — CID 10457164
4-[4-[5-[4-(4-methoxyphenyl)phenyl]-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]butane-1-sulfonate (PubChem CID 10457164) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is 4-[4-[5-[4-(4-methoxyphenyl)phenyl]-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | 4-[4-[5-[4-(4-methoxyphenyl)phenyl]-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 10457164 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 4-[4-[5-[4-(4-methoxyphenyl)phenyl]-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]butane-1-sulfonate |
| SMILES | COc1ccc(-c2ccc(-c3cnc(-c4cc[n+](CCCCS(=O)(=O)[O-])cc4)o3)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O5S/c1-31-23-10-8-20(9-11-23)19-4-6-21(7-5-19)24-18-26-25(32-24)22-12-15-27(16-13-22)14-2-3-17-33(28,29)30/h4-13,15-16,18H,2-3,14,17H2,1H3 |
| InChIKey | JBRSBHIFJTUQOE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 96.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|