C15H12ClN2O6+ — CID 88703781
[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl] perchlorate (PubChem CID 88703781) has the molecular formula C15H12ClN2O6+ and a molecular weight of 351.72 g/mol. Its IUPAC name is [4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl] perchlorate.
| Compound Name | [4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl] perchlorate |
|---|---|
| PubChem CID | 88703781 |
| Molecular Formula | C15H12ClN2O6+ |
| Molecular Weight | 351.72 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | [4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl] perchlorate |
| SMILES | COc1ccc(-c2cnc(-c3cc[n+](O[Cl+3]([O-])([O-])[O-])cc3)o2)cc1 |
| InChI | InChI=1S/C15H12ClN2O6/c1-22-13-4-2-11(3-5-13)14-10-17-15(23-14)12-6-8-18(9-7-12)24-16(19,20)21/h2-10H,1H3/q+1 |
| InChIKey | BQYSHTOLXSTMNA-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 117.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.72 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|