C15H13N3O2 — CID 71401542
4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-2-amine (PubChem CID 71401542) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-2-amine.
| Compound Name | 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 71401542 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-2-amine |
| SMILES | COc1ccc(-c2cnc(-c3ccnc(N)c3)o2)cc1 |
| InChI | InChI=1S/C15H13N3O2/c1-19-12-4-2-10(3-5-12)13-9-18-15(20-13)11-6-7-17-14(16)8-11/h2-9H,1H3,(H2,16,17) |
| InChIKey | ITYCXFPDQMVLBS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |