C17H16ClN3O3 — CID 68978229
3-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzohydrazide;hydrochloride (PubChem CID 68978229) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is 3-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzohydrazide;hydrochloride.
| Compound Name | 3-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzohydrazide;hydrochloride |
|---|---|
| PubChem CID | 68978229 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzohydrazide;hydrochloride |
| SMILES | COc1ccc(-c2cnc(-c3cccc(C(=O)NN)c3)o2)cc1.Cl |
| InChI | InChI=1S/C17H15N3O3.ClH/c1-22-14-7-5-11(6-8-14)15-10-19-17(23-15)13-4-2-3-12(9-13)16(21)20-18;/h2-10H,18H2,1H3,(H,20,21);1H |
| InChIKey | FIFHPCJEFCWPLK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|