3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid

C17H11NO5 — CID 57037595

IUPAC3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid
SMILESO=C(O)c1cccc(-c2cnc(-c3cccc(C(=O)O)c3)o2)c1
InChIInChI=1S/C17H11NO5/c19-16(20)12-5-1-3-10(7-12)14-9-18-15(23-14)11-4-2-6-13(8-11)17(21)22/h1-9H,(H,19,20)(H,21,22)
InChIKeyOJBFCQKLMRQULH-UHFFFAOYSA-N
MW309.28 g/mol
LogP3.40
Rot. Bonds4

About 3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid

3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid (PubChem CID 57037595) has the molecular formula C17H11NO5 and a molecular weight of 309.28 g/mol. Its IUPAC name is 3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid.

Molecular Properties

Compound Name3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid
PubChem CID57037595
Molecular FormulaC17H11NO5
Molecular Weight309.28 g/mol
Exact Mass309.06
IUPAC Name3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid
SMILESO=C(O)c1cccc(-c2cnc(-c3cccc(C(=O)O)c3)o2)c1
InChIInChI=1S/C17H11NO5/c19-16(20)12-5-1-3-10(7-12)14-9-18-15(23-14)11-4-2-6-13(8-11)17(21)22/h1-9H,(H,19,20)(H,21,22)
InChIKeyOJBFCQKLMRQULH-UHFFFAOYSA-N
XLogP3.40
TPSA100.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.28
LogP ≤ 53.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid?
The IUPAC name of 3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid (CID 57037595) is 3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid.
What is the SMILES notation for 3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid?
The canonical SMILES for 3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid is O=C(O)c1cccc(-c2cnc(-c3cccc(C(=O)O)c3)o2)c1.
What is the InChIKey of 3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid?
The InChIKey is OJBFCQKLMRQULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO5/c19-16(20)12-5-1-3-10(7-12)14-9-18-15(23-14)11-4-2-6-13(8-11)17(21)22/h1-9H,(H,19,20)(H,21,22).
What are the key properties of 3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid?
3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid has a molecular weight of 309.28 g/mol, XLogP of 3.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-carboxyphenyl)-1,3-oxazol-5-yl]benzoic acid is sourced from PubChem (CID 57037595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).