C17H16N2O2 — CID 143054394
5-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-2-methylaniline (PubChem CID 143054394) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-2-methylaniline.
| Compound Name | 5-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-2-methylaniline |
|---|---|
| PubChem CID | 143054394 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-2-methylaniline |
| SMILES | COc1ccc(-c2cnc(-c3ccc(C)c(N)c3)o2)cc1 |
| InChI | InChI=1S/C17H16N2O2/c1-11-3-4-13(9-15(11)18)17-19-10-16(21-17)12-5-7-14(20-2)8-6-12/h3-10H,18H2,1-2H3 |
| InChIKey | YNHBBMZLIWPYQP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|