C33H31N4O5+ — CID 59991727
N-[1-hydroxy-2-oxo-2-(1-phenylethylamino)ethyl]-3-[[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzamide (PubChem CID 59991727) has the molecular formula C33H31N4O5+ and a molecular weight of 563.63 g/mol. Its IUPAC name is N-[1-hydroxy-2-oxo-2-(1-phenylethylamino)ethyl]-3-[[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzamide.
| Compound Name | N-[1-hydroxy-2-oxo-2-(1-phenylethylamino)ethyl]-3-[[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 59991727 |
| Molecular Formula | C33H31N4O5+ |
| Molecular Weight | 563.63 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | N-[1-hydroxy-2-oxo-2-(1-phenylethylamino)ethyl]-3-[[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzamide |
| SMILES | COc1ccc(-c2cnc(-c3cc[n+](Cc4cccc(C(=O)NC(O)C(=O)NC(C)c5ccccc5)c4)cc3)o2)cc1 |
| InChI | InChI=1S/C33H30N4O5/c1-22(24-8-4-3-5-9-24)35-31(39)32(40)36-30(38)27-10-6-7-23(19-27)21-37-17-15-26(16-18-37)33-34-20-29(42-33)25-11-13-28(41-2)14-12-25/h3-20,22,32,40H,21H2,1-2H3,(H-,35,36,38,39)/p+1 |
| InChIKey | CKDXOLVSRSTGKH-UHFFFAOYSA-O |
| XLogP | 4.28 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|