C22H18N3O2S+ — CID 137079156
N-[3-[[4-[5-(4-hydroxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]phenyl]methanethioamide (PubChem CID 137079156) has the molecular formula C22H18N3O2S+ and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[3-[[4-[5-(4-hydroxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]phenyl]methanethioamide.
| Compound Name | N-[3-[[4-[5-(4-hydroxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]phenyl]methanethioamide |
|---|---|
| PubChem CID | 137079156 |
| Molecular Formula | C22H18N3O2S+ |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[3-[[4-[5-(4-hydroxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]phenyl]methanethioamide |
| SMILES | Oc1ccc(-c2cnc(-c3cc[n+](Cc4cccc(NC=S)c4)cc3)o2)cc1 |
| InChI | InChI=1S/C22H17N3O2S/c26-20-6-4-17(5-7-20)21-13-23-22(27-21)18-8-10-25(11-9-18)14-16-2-1-3-19(12-16)24-15-28/h1-13,15H,14H2,(H,24,28)/p+1 |
| InChIKey | SGWRILVBHPSILF-UHFFFAOYSA-O |
| XLogP | 4.42 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|