C17H17N2O5S+ — CID 10361157
2-[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]ethanesulfonic acid (PubChem CID 10361157) has the molecular formula C17H17N2O5S+ and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]ethanesulfonic acid.
| Compound Name | 2-[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 10361157 |
| Molecular Formula | C17H17N2O5S+ |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]ethanesulfonic acid |
| SMILES | COc1ccc(-c2cnc(-c3cc[n+](CCS(=O)(=O)O)cc3)o2)cc1 |
| InChI | InChI=1S/C17H16N2O5S/c1-23-15-4-2-13(3-5-15)16-12-18-17(24-16)14-6-8-19(9-7-14)10-11-25(20,21)22/h2-9,12H,10-11H2,1H3/p+1 |
| InChIKey | VTGRRASLERKJJJ-UHFFFAOYSA-O |
| XLogP | 2.19 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|