C20H20N2O5S — CID 3570882
4-[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]phenyl]sulfonylmorpholine (PubChem CID 3570882) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 3570882 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 4-[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]phenyl]sulfonylmorpholine |
| SMILES | COc1ccc(-c2cnc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)o2)cc1 |
| InChI | InChI=1S/C20H20N2O5S/c1-25-17-6-2-15(3-7-17)19-14-21-20(27-19)16-4-8-18(9-5-16)28(23,24)22-10-12-26-13-11-22/h2-9,14H,10-13H2,1H3 |
| InChIKey | YPVNBSLPUISVQA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |