C21H26N2O7S2 — CID 71671443
4-[4-(4-methoxy-2-morpholin-4-ylsulfonylphenyl)phenyl]sulfonylmorpholine (PubChem CID 71671443) has the molecular formula C21H26N2O7S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is 4-[4-(4-methoxy-2-morpholin-4-ylsulfonylphenyl)phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-(4-methoxy-2-morpholin-4-ylsulfonylphenyl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 71671443 |
| Molecular Formula | C21H26N2O7S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 4-[4-(4-methoxy-2-morpholin-4-ylsulfonylphenyl)phenyl]sulfonylmorpholine |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)N3CCOCC3)cc2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H26N2O7S2/c1-28-18-4-7-20(21(16-18)32(26,27)23-10-14-30-15-11-23)17-2-5-19(6-3-17)31(24,25)22-8-12-29-13-9-22/h2-7,16H,8-15H2,1H3 |
| InChIKey | VKTJLQCTLWSCJD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |