C16H17N3O3S — CID 156832573
3-[methyl(phenazin-2-yl)amino]propane-1-sulfonic acid (PubChem CID 156832573) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 3-[methyl(phenazin-2-yl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[methyl(phenazin-2-yl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 156832573 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-[methyl(phenazin-2-yl)amino]propane-1-sulfonic acid |
| SMILES | CN(CCCS(=O)(=O)O)c1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C16H17N3O3S/c1-19(9-4-10-23(20,21)22)12-7-8-15-16(11-12)18-14-6-3-2-5-13(14)17-15/h2-3,5-8,11H,4,9-10H2,1H3,(H,20,21,22) |
| InChIKey | ORAHRKCDKNGARM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|