C11H15N7O3S2 — CID 59471034
3-[methyl-[6-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]pyridazin-3-yl]amino]propane-1-sulfonic acid (PubChem CID 59471034) has the molecular formula C11H15N7O3S2 and a molecular weight of 357.42 g/mol. Its IUPAC name is 3-[methyl-[6-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]pyridazin-3-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[methyl-[6-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]pyridazin-3-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59471034 |
| Molecular Formula | C11H15N7O3S2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 3-[methyl-[6-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]pyridazin-3-yl]amino]propane-1-sulfonic acid |
| SMILES | Cc1nsc(/N=N/c2ccc(N(C)CCCS(=O)(=O)O)nn2)n1 |
| InChI | InChI=1S/C11H15N7O3S2/c1-8-12-11(22-17-8)16-14-9-4-5-10(15-13-9)18(2)6-3-7-23(19,20)21/h4-5H,3,6-7H2,1-2H3,(H,19,20,21)/b16-14+ |
| InChIKey | NDYZTSVKOATEIO-JQIJEIRASA-N |
| XLogP | 1.77 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|