C9H11N4O3S2+ — CID 156626111
2-[4-(3-methyl-1,2,4-thiadiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid (PubChem CID 156626111) has the molecular formula C9H11N4O3S2+ and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-[4-(3-methyl-1,2,4-thiadiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid.
| Compound Name | 2-[4-(3-methyl-1,2,4-thiadiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 156626111 |
| Molecular Formula | C9H11N4O3S2+ |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-[4-(3-methyl-1,2,4-thiadiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid |
| SMILES | Cc1nsc(-c2cc[n+](CCS(=O)(=O)O)nc2)n1 |
| InChI | InChI=1S/C9H10N4O3S2/c1-7-11-9(17-12-7)8-2-3-13(10-6-8)4-5-18(14,15)16/h2-3,6H,4-5H2,1H3/p+1 |
| InChIKey | PZDNDUTULMUAJK-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|