C19H20N2O7S2 — CID 162687754
2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 162687754) has the molecular formula C19H20N2O7S2 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 162687754 |
| Molecular Formula | C19H20N2O7S2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CN(CCCCS(=O)(=O)O)c1ccc2cc(-c3nc(CC(=O)O)cs3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H20N2O7S2/c1-21(6-2-3-7-30(25,26)27)14-5-4-12-8-15(19(24)28-16(12)10-14)18-20-13(11-29-18)9-17(22)23/h4-5,8,10-11H,2-3,6-7,9H2,1H3,(H,22,23)(H,25,26,27) |
| InChIKey | VDZGPZFLLUJZKY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|