About 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid
2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 162687754) has the molecular formula C19H20N2O7S2
and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid |
| PubChem CID | 162687754 |
| Molecular Formula | C19H20N2O7S2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CN(CCCCS(=O)(=O)O)c1ccc2cc(-c3nc(CC(=O)O)cs3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H20N2O7S2/c1-21(6-2-3-7-30(25,26)27)14-5-4-12-8-15(19(24)28-16(12)10-14)18-20-13(11-29-18)9-17(22)23/h4-5,8,10-11H,2-3,6-7,9H2,1H3,(H,22,23)(H,25,26,27) |
| InChIKey | VDZGPZFLLUJZKY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid (CID 162687754) is 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid is CN(CCCCS(=O)(=O)O)c1ccc2cc(-c3nc(CC(=O)O)cs3)c(=O)oc2c1.
What is the InChIKey of 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid?
The InChIKey is VDZGPZFLLUJZKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O7S2/c1-21(6-2-3-7-30(25,26)27)14-5-4-12-8-15(19(24)28-16(12)10-14)18-20-13(11-29-18)9-17(22)23/h4-5,8,10-11H,2-3,6-7,9H2,1H3,(H,22,23)(H,25,26,27).
What are the key properties of 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid?
2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid has a molecular weight of 452.51 g/mol, XLogP of 2.65, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[7-[methyl(4-sulfobutyl)amino]-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 162687754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).