C21H19N3O7S — CID 157342204
4-[methyl-[2-oxo-3-[6-(sulfinoamino)-1,3-benzoxazol-2-yl]chromen-7-yl]amino]butanoic acid (PubChem CID 157342204) has the molecular formula C21H19N3O7S and a molecular weight of 457.46 g/mol. Its IUPAC name is 4-[methyl-[2-oxo-3-[6-(sulfinoamino)-1,3-benzoxazol-2-yl]chromen-7-yl]amino]butanoic acid.
| Compound Name | 4-[methyl-[2-oxo-3-[6-(sulfinoamino)-1,3-benzoxazol-2-yl]chromen-7-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 157342204 |
| Molecular Formula | C21H19N3O7S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 4-[methyl-[2-oxo-3-[6-(sulfinoamino)-1,3-benzoxazol-2-yl]chromen-7-yl]amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)c1ccc2cc(-c3nc4ccc(NS(=O)O)cc4o3)c(=O)oc2c1 |
| InChI | InChI=1S/C21H19N3O7S/c1-24(8-2-3-19(25)26)14-6-4-12-9-15(21(27)31-17(12)11-14)20-22-16-7-5-13(23-32(28)29)10-18(16)30-20/h4-7,9-11,23H,2-3,8H2,1H3,(H,25,26)(H,28,29) |
| InChIKey | QTFCVYPYSJOBBA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 146.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|