C26H22N2O7 — CID 171502624
2-[[3-(1,3-benzoxazol-2-yl)-2-oxochromen-7-yl]-(2-prop-2-enoyloxyethyl)amino]ethyl prop-2-enoate (PubChem CID 171502624) has the molecular formula C26H22N2O7 and a molecular weight of 474.47 g/mol. Its IUPAC name is 2-[[3-(1,3-benzoxazol-2-yl)-2-oxochromen-7-yl]-(2-prop-2-enoyloxyethyl)amino]ethyl prop-2-enoate.
| Compound Name | 2-[[3-(1,3-benzoxazol-2-yl)-2-oxochromen-7-yl]-(2-prop-2-enoyloxyethyl)amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 171502624 |
| Molecular Formula | C26H22N2O7 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-[[3-(1,3-benzoxazol-2-yl)-2-oxochromen-7-yl]-(2-prop-2-enoyloxyethyl)amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(CCOC(=O)C=C)c1ccc2cc(-c3nc4ccccc4o3)c(=O)oc2c1 |
| InChI | InChI=1S/C26H22N2O7/c1-3-23(29)32-13-11-28(12-14-33-24(30)4-2)18-10-9-17-15-19(26(31)35-22(17)16-18)25-27-20-7-5-6-8-21(20)34-25/h3-10,15-16H,1-2,11-14H2 |
| InChIKey | WZYMQQBJPSNTKP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 112.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|