C30H38O5 — CID 145263388
ethane;[(E)-8-(2-oxo-3-phenylchromen-7-yl)oxyoct-4-enyl] prop-2-enoate (PubChem CID 145263388) has the molecular formula C30H38O5 and a molecular weight of 478.63 g/mol. Its IUPAC name is ethane;[(E)-8-(2-oxo-3-phenylchromen-7-yl)oxyoct-4-enyl] prop-2-enoate.
| Compound Name | ethane;[(E)-8-(2-oxo-3-phenylchromen-7-yl)oxyoct-4-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 145263388 |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | ethane;[(E)-8-(2-oxo-3-phenylchromen-7-yl)oxyoct-4-enyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC/C=C/CCCOc1ccc2cc(-c3ccccc3)c(=O)oc2c1.CC.CC |
| InChI | InChI=1S/C26H26O5.2C2H6/c1-2-25(27)30-17-11-6-4-3-5-10-16-29-22-15-14-21-18-23(20-12-8-7-9-13-20)26(28)31-24(21)19-22;2*1-2/h2-4,7-9,12-15,18-19H,1,5-6,10-11,16-17H2;2*1-2H3/b4-3+;; |
| InChIKey | TVQVAMIHUAWCGI-CZEFNJPISA-N |
| XLogP | 7.74 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|