C50H54O10 — CID 153454812
[6-[1,7-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-5-hydroxyhexyl] prop-2-enoate (PubChem CID 153454812) has the molecular formula C50H54O10 and a molecular weight of 814.97 g/mol. Its IUPAC name is [6-[1,7-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-5-hydroxyhexyl] prop-2-enoate.
| Compound Name | [6-[1,7-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-5-hydroxyhexyl] prop-2-enoate |
|---|---|
| PubChem CID | 153454812 |
| Molecular Formula | C50H54O10 |
| Molecular Weight | 814.97 g/mol |
| Exact Mass | 814.37 |
| IUPAC Name | [6-[1,7-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-5-hydroxyhexyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCCC(O)COC(CCCOc1ccc2cc(-c3ccccc3CC)c(=O)oc2c1)CCCOc1ccc2cc(-c3ccccc3CC)c(=O)oc2c1 |
| InChI | InChI=1S/C50H54O10/c1-4-34-15-7-9-20-42(34)44-29-36-22-24-40(31-46(36)59-49(44)53)55-27-13-18-39(58-33-38(51)17-11-12-26-57-48(52)6-3)19-14-28-56-41-25-23-37-30-45(50(54)60-47(37)32-41)43-21-10-8-16-35(43)5-2/h6-10,15-16,20-25,29-32,38-39,51H,3-5,11-14,17-19,26-28,33H2,1-2H3 |
| InChIKey | OWUYUIXTSWPNPO-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.97 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|