C50H48F6O9 — CID 153454792
[5-[1,7-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate (PubChem CID 153454792) has the molecular formula C50H48F6O9 and a molecular weight of 906.91 g/mol. Its IUPAC name is [5-[1,7-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate.
| Compound Name | [5-[1,7-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153454792 |
| Molecular Formula | C50H48F6O9 |
| Molecular Weight | 906.91 g/mol |
| Exact Mass | 906.32 |
| IUPAC Name | [5-[1,7-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)COC(CCCOc1ccc2cc(-c3ccccc3CC)c(=O)oc2c1)CCCOc1ccc2cc(-c3ccccc3CC)c(=O)oc2c1 |
| InChI | InChI=1S/C50H48F6O9/c1-5-32-13-7-9-17-39(32)41-25-34-19-21-37(27-43(34)64-46(41)58)60-23-11-15-36(62-29-48(51,52)50(55,56)49(53,54)30-63-45(57)31(3)4)16-12-24-61-38-22-20-35-26-42(47(59)65-44(35)28-38)40-18-10-8-14-33(40)6-2/h7-10,13-14,17-22,25-28,36H,3,5-6,11-12,15-16,23-24,29-30H2,1-2,4H3 |
| InChIKey | CFQPMZWEUBSWJE-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 114.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.91 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|