C46H40F6O9 — CID 146412119
[5-[1,3-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]propan-2-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate (PubChem CID 146412119) has the molecular formula C46H40F6O9 and a molecular weight of 850.81 g/mol. Its IUPAC name is [5-[1,3-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]propan-2-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate.
| Compound Name | [5-[1,3-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]propan-2-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146412119 |
| Molecular Formula | C46H40F6O9 |
| Molecular Weight | 850.81 g/mol |
| Exact Mass | 850.26 |
| IUPAC Name | [5-[1,3-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]propan-2-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)COC(COc1ccc2cc(-c3ccccc3CC)c(=O)oc2c1)COc1ccc2cc(-c3ccccc3CC)c(=O)oc2c1 |
| InChI | InChI=1S/C46H40F6O9/c1-5-28-11-7-9-13-35(28)37-19-30-15-17-32(21-39(30)60-42(37)54)56-23-34(58-25-44(47,48)46(51,52)45(49,50)26-59-41(53)27(3)4)24-57-33-18-16-31-20-38(43(55)61-40(31)22-33)36-14-10-8-12-29(36)6-2/h7-22,34H,3,5-6,23-26H2,1-2,4H3 |
| InChIKey | WQVSXIODTFLVBJ-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 114.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.81 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|