C50H48F6O9 — CID 153454849
1,3-bis[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-6-yl]oxy]propan-2-yloxymethyl 2-methylprop-2-enoate (PubChem CID 153454849) has the molecular formula C50H48F6O9 and a molecular weight of 906.91 g/mol. Its IUPAC name is 1,3-bis[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-6-yl]oxy]propan-2-yloxymethyl 2-methylprop-2-enoate.
| Compound Name | 1,3-bis[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-6-yl]oxy]propan-2-yloxymethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153454849 |
| Molecular Formula | C50H48F6O9 |
| Molecular Weight | 906.91 g/mol |
| Exact Mass | 906.32 |
| IUPAC Name | 1,3-bis[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-6-yl]oxy]propan-2-yloxymethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCOC(COc1ccc2oc(=O)c(-c3ccc(CCCCC)cc3C(F)(F)F)cc2c1)COc1ccc2oc(=O)c(-c3ccc(CCCCC)cc3C(F)(F)F)cc2c1 |
| InChI | InChI=1S/C50H48F6O9/c1-5-7-9-11-31-13-17-38(42(21-31)49(51,52)53)40-25-33-23-35(15-19-44(33)64-47(40)58)60-27-37(62-29-63-46(57)30(3)4)28-61-36-16-20-45-34(24-36)26-41(48(59)65-45)39-18-14-32(12-10-8-6-2)22-43(39)50(54,55)56/h13-26,37H,3,5-12,27-29H2,1-2,4H3 |
| InChIKey | HMBGSPPGMURNRI-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 114.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.91 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|