C22H21F3O3 — CID 166685930
7-methoxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one (PubChem CID 166685930) has the molecular formula C22H21F3O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is 7-methoxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one.
| Compound Name | 7-methoxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 166685930 |
| Molecular Formula | C22H21F3O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 7-methoxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OC)cc3oc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F3O3/c1-3-4-5-6-14-7-10-17(19(11-14)22(23,24)25)18-12-15-8-9-16(27-2)13-20(15)28-21(18)26/h7-13H,3-6H2,1-2H3 |
| InChIKey | FFIKEMVTAUTEHU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|