C24H22F6O3S — CID 162619301
7-[(E)-ethylidene(trifluoromethyl)-λ4-sulfanyl]oxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one (PubChem CID 162619301) has the molecular formula C24H22F6O3S and a molecular weight of 504.49 g/mol. Its IUPAC name is 7-[(E)-ethylidene(trifluoromethyl)-λ4-sulfanyl]oxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one.
| Compound Name | 7-[(E)-ethylidene(trifluoromethyl)-λ4-sulfanyl]oxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 162619301 |
| Molecular Formula | C24H22F6O3S |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 7-[(E)-ethylidene(trifluoromethyl)-λ4-sulfanyl]oxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one |
| SMILES | C/C=S(/Oc1ccc2cc(-c3ccc(CCCCC)cc3C(F)(F)F)c(=O)oc2c1)C(F)(F)F |
| InChI | InChI=1S/C24H22F6O3S/c1-3-5-6-7-15-8-11-18(20(12-15)23(25,26)27)19-13-16-9-10-17(14-21(16)32-22(19)31)33-34(4-2)24(28,29)30/h4,8-14H,3,5-7H2,1-2H3 |
| InChIKey | HTPFQBDVVVJYBB-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|