C33H31F11O4S — CID 170022747
[3,3,4,4,5,5,6,6-octafluoro-8-[3-[4-hexyl-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]sulfanyloctyl] prop-2-enoate (PubChem CID 170022747) has the molecular formula C33H31F11O4S and a molecular weight of 732.65 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[3-[4-hexyl-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]sulfanyloctyl] prop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[3-[4-hexyl-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]sulfanyloctyl] prop-2-enoate |
|---|---|
| PubChem CID | 170022747 |
| Molecular Formula | C33H31F11O4S |
| Molecular Weight | 732.65 g/mol |
| Exact Mass | 732.18 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[3-[4-hexyl-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]sulfanyloctyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCSc1ccc2cc(-c3ccc(CCCCCC)cc3C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C33H31F11O4S/c1-3-5-6-7-8-20-9-12-23(25(17-20)31(38,39)40)24-18-21-10-11-22(19-26(21)48-28(24)46)49-16-14-30(36,37)33(43,44)32(41,42)29(34,35)13-15-47-27(45)4-2/h4,9-12,17-19H,2-3,5-8,13-16H2,1H3 |
| InChIKey | DJPRSGLJTCAIJU-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.65 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|