C27H29F3O4 — CID 146390852
[2-methyl-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]propyl] prop-2-enoate (PubChem CID 146390852) has the molecular formula C27H29F3O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is [2-methyl-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]propyl] prop-2-enoate.
| Compound Name | [2-methyl-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390852 |
| Molecular Formula | C27H29F3O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | [2-methyl-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)COc1ccc2cc(-c3ccc(CCCCC)cc3C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C27H29F3O4/c1-4-6-7-8-19-9-12-22(23(13-19)27(28,29)30)25-14-20-10-11-21(15-24(20)34-25)32-16-18(3)17-33-26(31)5-2/h5,9-15,18H,2,4,6-8,16-17H2,1,3H3 |
| InChIKey | LSISXLXEJDTDKN-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|