C29H31F3O5 — CID 170017671
[4,4,4-trifluoro-2-[[3-(2-methyl-4-pentylphenyl)-2-oxochromen-7-yl]oxymethyl]butyl] prop-2-enoate (PubChem CID 170017671) has the molecular formula C29H31F3O5 and a molecular weight of 516.56 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-[[3-(2-methyl-4-pentylphenyl)-2-oxochromen-7-yl]oxymethyl]butyl] prop-2-enoate.
| Compound Name | [4,4,4-trifluoro-2-[[3-(2-methyl-4-pentylphenyl)-2-oxochromen-7-yl]oxymethyl]butyl] prop-2-enoate |
|---|---|
| PubChem CID | 170017671 |
| Molecular Formula | C29H31F3O5 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | [4,4,4-trifluoro-2-[[3-(2-methyl-4-pentylphenyl)-2-oxochromen-7-yl]oxymethyl]butyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COc1ccc2cc(-c3ccc(CCCCC)cc3C)c(=O)oc2c1)CC(F)(F)F |
| InChI | InChI=1S/C29H31F3O5/c1-4-6-7-8-20-9-12-24(19(3)13-20)25-14-22-10-11-23(15-26(22)37-28(25)34)35-17-21(16-29(30,31)32)18-36-27(33)5-2/h5,9-15,21H,2,4,6-8,16-18H2,1,3H3 |
| InChIKey | VFVRSWXEHNXRSI-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|