C29H33F3O3S — CID 146391389
[2-[[2-(2-ethyl-4-pentylphenyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate (PubChem CID 146391389) has the molecular formula C29H33F3O3S and a molecular weight of 518.64 g/mol. Its IUPAC name is [2-[[2-(2-ethyl-4-pentylphenyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate.
| Compound Name | [2-[[2-(2-ethyl-4-pentylphenyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate |
|---|---|
| PubChem CID | 146391389 |
| Molecular Formula | C29H33F3O3S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | [2-[[2-(2-ethyl-4-pentylphenyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COc1ccc2cc(-c3ccc(CCCCC)cc3CC)sc2c1)CC(F)(F)F |
| InChI | InChI=1S/C29H33F3O3S/c1-4-7-8-9-20-10-13-25(22(5-2)14-20)27-15-23-11-12-24(16-26(23)36-27)34-18-21(17-29(30,31)32)19-35-28(33)6-3/h6,10-16,21H,3-5,7-9,17-19H2,1-2H3 |
| InChIKey | CZTNMUNZFCOUTI-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|