C30H39F3N2O3S — CID 155266358
[2-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] 3,5-diamino-2,2,5-trimethylhexanoate (PubChem CID 155266358) has the molecular formula C30H39F3N2O3S and a molecular weight of 564.71 g/mol. Its IUPAC name is [2-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] 3,5-diamino-2,2,5-trimethylhexanoate.
| Compound Name | [2-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] 3,5-diamino-2,2,5-trimethylhexanoate |
|---|---|
| PubChem CID | 155266358 |
| Molecular Formula | C30H39F3N2O3S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | [2-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] 3,5-diamino-2,2,5-trimethylhexanoate |
| SMILES | CCc1ccccc1-c1cc2ccc(OCC(COC(=O)C(C)(C)C(N)CC(C)(C)N)CC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C30H39F3N2O3S/c1-6-20-9-7-8-10-23(20)25-13-21-11-12-22(14-24(21)39-25)37-17-19(15-30(31,32)33)18-38-27(36)29(4,5)26(34)16-28(2,3)35/h7-14,19,26H,6,15-18,34-35H2,1-5H3 |
| InChIKey | KGPFHUSOMAQUOD-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |