C21H20O3S — CID 157229196
[2-methyl-3-[(2-phenyl-1-benzothiophen-6-yl)oxy]propyl] prop-2-enoate (PubChem CID 157229196) has the molecular formula C21H20O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is [2-methyl-3-[(2-phenyl-1-benzothiophen-6-yl)oxy]propyl] prop-2-enoate.
| Compound Name | [2-methyl-3-[(2-phenyl-1-benzothiophen-6-yl)oxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 157229196 |
| Molecular Formula | C21H20O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [2-methyl-3-[(2-phenyl-1-benzothiophen-6-yl)oxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)COc1ccc2cc(-c3ccccc3)sc2c1 |
| InChI | InChI=1S/C21H20O3S/c1-3-21(22)24-14-15(2)13-23-18-10-9-17-11-19(25-20(17)12-18)16-7-5-4-6-8-16/h3-12,15H,1,13-14H2,2H3 |
| InChIKey | KDPKLZIFFYHCOP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|