C29H30O7S — CID 139967387
4-prop-2-enoyloxybutyl 4-[5-(4-prop-2-enoyloxybutoxy)-1-benzothiophen-2-yl]benzoate (PubChem CID 139967387) has the molecular formula C29H30O7S and a molecular weight of 522.62 g/mol. Its IUPAC name is 4-prop-2-enoyloxybutyl 4-[5-(4-prop-2-enoyloxybutoxy)-1-benzothiophen-2-yl]benzoate.
| Compound Name | 4-prop-2-enoyloxybutyl 4-[5-(4-prop-2-enoyloxybutoxy)-1-benzothiophen-2-yl]benzoate |
|---|---|
| PubChem CID | 139967387 |
| Molecular Formula | C29H30O7S |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 4-prop-2-enoyloxybutyl 4-[5-(4-prop-2-enoyloxybutoxy)-1-benzothiophen-2-yl]benzoate |
| SMILES | C=CC(=O)OCCCCOC(=O)c1ccc(-c2cc3cc(OCCCCOC(=O)C=C)ccc3s2)cc1 |
| InChI | InChI=1S/C29H30O7S/c1-3-27(30)34-16-6-5-15-33-24-13-14-25-23(19-24)20-26(37-25)21-9-11-22(12-10-21)29(32)36-18-8-7-17-35-28(31)4-2/h3-4,9-14,19-20H,1-2,5-8,15-18H2 |
| InChIKey | IXSQNOVSKBIHSR-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|