C42H44O6S2 — CID 20807421
6-[4-[2-[2-[4-(6-prop-2-enylperoxyhexoxy)phenyl]thieno[2,3-f][1]benzothiol-6-yl]ethynyl]phenoxy]hexyl prop-2-enoate (PubChem CID 20807421) has the molecular formula C42H44O6S2 and a molecular weight of 708.94 g/mol. Its IUPAC name is 6-[4-[2-[2-[4-(6-prop-2-enylperoxyhexoxy)phenyl]thieno[2,3-f][1]benzothiol-6-yl]ethynyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[2-[2-[4-(6-prop-2-enylperoxyhexoxy)phenyl]thieno[2,3-f][1]benzothiol-6-yl]ethynyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 20807421 |
| Molecular Formula | C42H44O6S2 |
| Molecular Weight | 708.94 g/mol |
| Exact Mass | 708.26 |
| IUPAC Name | 6-[4-[2-[2-[4-(6-prop-2-enylperoxyhexoxy)phenyl]thieno[2,3-f][1]benzothiol-6-yl]ethynyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CCOOCCCCCCOc1ccc(-c2cc3cc4sc(C#Cc5ccc(OCCCCCCOC(=O)C=C)cc5)cc4cc3s2)cc1 |
| InChI | InChI=1S/C42H44O6S2/c1-3-23-47-48-27-12-8-7-10-25-45-37-20-16-33(17-21-37)39-30-35-31-40-34(29-41(35)50-39)28-38(49-40)22-15-32-13-18-36(19-14-32)44-24-9-5-6-11-26-46-42(43)4-2/h3-4,13-14,16-21,28-31H,1-2,5-12,23-27H2 |
| InChIKey | XAFWNARGKOIWMQ-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.94 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|