C22H19F3O4S — CID 155005012
[2-hydroxy-3-[[2-[4-methyl-2-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]oxy]propyl] prop-2-enoate (PubChem CID 155005012) has the molecular formula C22H19F3O4S and a molecular weight of 436.45 g/mol. Its IUPAC name is [2-hydroxy-3-[[2-[4-methyl-2-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]oxy]propyl] prop-2-enoate.
| Compound Name | [2-hydroxy-3-[[2-[4-methyl-2-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]oxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 155005012 |
| Molecular Formula | C22H19F3O4S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | [2-hydroxy-3-[[2-[4-methyl-2-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]oxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COc1ccc2cc(-c3ccc(C)cc3C(F)(F)F)sc2c1 |
| InChI | InChI=1S/C22H19F3O4S/c1-3-21(27)29-12-15(26)11-28-16-6-5-14-9-20(30-19(14)10-16)17-7-4-13(2)8-18(17)22(23,24)25/h3-10,15,26H,1,11-12H2,2H3 |
| InChIKey | XLQKELPFMREECG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|