C37H36O3S2 — CID 155236261
1,3-bis[[2-(2-ethyl-4-methylphenyl)-1-benzothiophen-5-yl]oxy]propan-2-ol (PubChem CID 155236261) has the molecular formula C37H36O3S2 and a molecular weight of 592.83 g/mol. Its IUPAC name is 1,3-bis[[2-(2-ethyl-4-methylphenyl)-1-benzothiophen-5-yl]oxy]propan-2-ol.
| Compound Name | 1,3-bis[[2-(2-ethyl-4-methylphenyl)-1-benzothiophen-5-yl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 155236261 |
| Molecular Formula | C37H36O3S2 |
| Molecular Weight | 592.83 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 1,3-bis[[2-(2-ethyl-4-methylphenyl)-1-benzothiophen-5-yl]oxy]propan-2-ol |
| SMILES | CCc1cc(C)ccc1-c1cc2cc(OCC(O)COc3ccc4sc(-c5ccc(C)cc5CC)cc4c3)ccc2s1 |
| InChI | InChI=1S/C37H36O3S2/c1-5-25-15-23(3)7-11-32(25)36-19-27-17-30(9-13-34(27)41-36)39-21-29(38)22-40-31-10-14-35-28(18-31)20-37(42-35)33-12-8-24(4)16-26(33)6-2/h7-20,29,38H,5-6,21-22H2,1-4H3 |
| InChIKey | MDLQVZDMVMTLHD-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.83 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |