C30H37F3O9S — CID 155005049
[4,5,7,8-tetrahydroxy-9-[[2-[5-pentyl-3-(trifluoromethoxy)furan-2-yl]-1-benzothiophen-6-yl]oxy]nonyl] prop-2-enoate (PubChem CID 155005049) has the molecular formula C30H37F3O9S and a molecular weight of 630.68 g/mol. Its IUPAC name is [4,5,7,8-tetrahydroxy-9-[[2-[5-pentyl-3-(trifluoromethoxy)furan-2-yl]-1-benzothiophen-6-yl]oxy]nonyl] prop-2-enoate.
| Compound Name | [4,5,7,8-tetrahydroxy-9-[[2-[5-pentyl-3-(trifluoromethoxy)furan-2-yl]-1-benzothiophen-6-yl]oxy]nonyl] prop-2-enoate |
|---|---|
| PubChem CID | 155005049 |
| Molecular Formula | C30H37F3O9S |
| Molecular Weight | 630.68 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | [4,5,7,8-tetrahydroxy-9-[[2-[5-pentyl-3-(trifluoromethoxy)furan-2-yl]-1-benzothiophen-6-yl]oxy]nonyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(O)C(O)CC(O)C(O)COc1ccc2cc(-c3oc(CCCCC)cc3OC(F)(F)F)sc2c1 |
| InChI | InChI=1S/C30H37F3O9S/c1-3-5-6-8-20-14-25(42-30(31,32)33)29(41-20)27-13-18-10-11-19(15-26(18)43-27)40-17-24(37)23(36)16-22(35)21(34)9-7-12-39-28(38)4-2/h4,10-11,13-15,21-24,34-37H,2-3,5-9,12,16-17H2,1H3 |
| InChIKey | FPAWTXLPXNPTKZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|