C24H27NO5 — CID 154601572
[4,5-dihydroxy-6-(1-methyl-2-phenylindol-6-yl)oxyhexyl] prop-2-enoate (PubChem CID 154601572) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is [4,5-dihydroxy-6-(1-methyl-2-phenylindol-6-yl)oxyhexyl] prop-2-enoate.
| Compound Name | [4,5-dihydroxy-6-(1-methyl-2-phenylindol-6-yl)oxyhexyl] prop-2-enoate |
|---|---|
| PubChem CID | 154601572 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [4,5-dihydroxy-6-(1-methyl-2-phenylindol-6-yl)oxyhexyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(O)C(O)COc1ccc2cc(-c3ccccc3)n(C)c2c1 |
| InChI | InChI=1S/C24H27NO5/c1-3-24(28)29-13-7-10-22(26)23(27)16-30-19-12-11-18-14-20(25(2)21(18)15-19)17-8-5-4-6-9-17/h3-6,8-9,11-12,14-15,22-23,26-27H,1,7,10,13,16H2,2H3 |
| InChIKey | JKDYZNQTMNSPGW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|