C25H27F2NO3 — CID 146391181
[4,4-difluoro-7-[4-(1-methylindol-2-yl)phenoxy]heptyl] prop-2-enoate (PubChem CID 146391181) has the molecular formula C25H27F2NO3 and a molecular weight of 427.49 g/mol. Its IUPAC name is [4,4-difluoro-7-[4-(1-methylindol-2-yl)phenoxy]heptyl] prop-2-enoate.
| Compound Name | [4,4-difluoro-7-[4-(1-methylindol-2-yl)phenoxy]heptyl] prop-2-enoate |
|---|---|
| PubChem CID | 146391181 |
| Molecular Formula | C25H27F2NO3 |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [4,4-difluoro-7-[4-(1-methylindol-2-yl)phenoxy]heptyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(F)(F)CCCOc1ccc(-c2cc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C25H27F2NO3/c1-3-24(29)31-17-7-15-25(26,27)14-6-16-30-21-12-10-19(11-13-21)23-18-20-8-4-5-9-22(20)28(23)2/h3-5,8-13,18H,1,6-7,14-17H2,2H3 |
| InChIKey | VRYWSNKOKNMRAM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|