C22H20F3NO3 — CID 146391415
[3,3,3-trifluoro-2-[(1-methyl-2-phenylindol-6-yl)oxymethyl]propyl] prop-2-enoate (PubChem CID 146391415) has the molecular formula C22H20F3NO3 and a molecular weight of 403.40 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-[(1-methyl-2-phenylindol-6-yl)oxymethyl]propyl] prop-2-enoate.
| Compound Name | [3,3,3-trifluoro-2-[(1-methyl-2-phenylindol-6-yl)oxymethyl]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 146391415 |
| Molecular Formula | C22H20F3NO3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [3,3,3-trifluoro-2-[(1-methyl-2-phenylindol-6-yl)oxymethyl]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COc1ccc2cc(-c3ccccc3)n(C)c2c1)C(F)(F)F |
| InChI | InChI=1S/C22H20F3NO3/c1-3-21(27)29-14-17(22(23,24)25)13-28-18-10-9-16-11-19(26(2)20(16)12-18)15-7-5-4-6-8-15/h3-12,17H,1,13-14H2,2H3 |
| InChIKey | XRHLGTKADIDLBF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|