C27H33NO3 — CID 158932710
[3-[2-(4-ethylphenyl)-1-propan-2-ylindol-6-yl]oxy-2,2-dimethylpropyl] prop-2-enoate (PubChem CID 158932710) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is [3-[2-(4-ethylphenyl)-1-propan-2-ylindol-6-yl]oxy-2,2-dimethylpropyl] prop-2-enoate.
| Compound Name | [3-[2-(4-ethylphenyl)-1-propan-2-ylindol-6-yl]oxy-2,2-dimethylpropyl] prop-2-enoate |
|---|---|
| PubChem CID | 158932710 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | [3-[2-(4-ethylphenyl)-1-propan-2-ylindol-6-yl]oxy-2,2-dimethylpropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(C)COc1ccc2cc(-c3ccc(CC)cc3)n(C(C)C)c2c1 |
| InChI | InChI=1S/C27H33NO3/c1-7-20-9-11-21(12-10-20)24-15-22-13-14-23(16-25(22)28(24)19(3)4)30-17-27(5,6)18-31-26(29)8-2/h8-16,19H,2,7,17-18H2,1,3-6H3 |
| InChIKey | YVGMNFJLTVEXTR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|