C32H40F3NO3 — CID 146390784
[2-[[2-(2-ethyl-4-pentylphenyl)-1-propan-2-ylindol-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate (PubChem CID 146390784) has the molecular formula C32H40F3NO3 and a molecular weight of 543.67 g/mol. Its IUPAC name is [2-[[2-(2-ethyl-4-pentylphenyl)-1-propan-2-ylindol-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate.
| Compound Name | [2-[[2-(2-ethyl-4-pentylphenyl)-1-propan-2-ylindol-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390784 |
| Molecular Formula | C32H40F3NO3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | [2-[[2-(2-ethyl-4-pentylphenyl)-1-propan-2-ylindol-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COc1ccc2cc(-c3ccc(CCCCC)cc3CC)n(C(C)C)c2c1)CC(F)(F)F |
| InChI | InChI=1S/C32H40F3NO3/c1-6-9-10-11-23-12-15-28(25(7-2)16-23)30-17-26-13-14-27(18-29(26)36(30)22(4)5)38-20-24(19-32(33,34)35)21-39-31(37)8-3/h8,12-18,22,24H,3,6-7,9-11,19-21H2,1-2,4-5H3 |
| InChIKey | FENOWLFHJTXGAE-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|