C36H44F6O5 — CID 155262515
[4,4,4-trifluoro-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxymethyl]butyl] 2-tert-butyl-3,3-dimethylbutanoate (PubChem CID 155262515) has the molecular formula C36H44F6O5 and a molecular weight of 670.73 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxymethyl]butyl] 2-tert-butyl-3,3-dimethylbutanoate.
| Compound Name | [4,4,4-trifluoro-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxymethyl]butyl] 2-tert-butyl-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 155262515 |
| Molecular Formula | C36H44F6O5 |
| Molecular Weight | 670.73 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | [4,4,4-trifluoro-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxymethyl]butyl] 2-tert-butyl-3,3-dimethylbutanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCC(COC(=O)C(C(C)(C)C)C(C)(C)C)CC(F)(F)F)cc3oc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C36H44F6O5/c1-8-9-10-11-22-12-15-26(28(16-22)36(40,41)42)27-17-24-13-14-25(18-29(24)47-31(27)43)45-20-23(19-35(37,38)39)21-46-32(44)30(33(2,3)4)34(5,6)7/h12-18,23,30H,8-11,19-21H2,1-7H3 |
| InChIKey | DCIMGZVXZDYWMY-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.73 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|