C30H33F3O5 — CID 145263260
[2,3-dimethyl-3-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxybutan-2-yl] prop-2-enoate (PubChem CID 145263260) has the molecular formula C30H33F3O5 and a molecular weight of 530.58 g/mol. Its IUPAC name is [2,3-dimethyl-3-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxybutan-2-yl] prop-2-enoate.
| Compound Name | [2,3-dimethyl-3-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxybutan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 145263260 |
| Molecular Formula | C30H33F3O5 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | [2,3-dimethyl-3-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxybutan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)C(C)(C)Oc1ccc2cc(-c3ccc(CCCCC)cc3C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C30H33F3O5/c1-7-9-10-11-19-12-15-22(24(16-19)30(31,32)33)23-17-20-13-14-21(18-25(20)36-27(23)35)37-28(3,4)29(5,6)38-26(34)8-2/h8,12-18H,2,7,9-11H2,1,3-6H3 |
| InChIKey | PTPHDFNLXHZZPQ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|