C32H29F11O6 — CID 153306097
[3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxyoctyl] prop-2-enoate (PubChem CID 153306097) has the molecular formula C32H29F11O6 and a molecular weight of 718.56 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxyoctyl] prop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxyoctyl] prop-2-enoate |
|---|---|
| PubChem CID | 153306097 |
| Molecular Formula | C32H29F11O6 |
| Molecular Weight | 718.56 g/mol |
| Exact Mass | 718.18 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxyoctyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1ccc2cc(-c3ccc(CCCCC)cc3OC(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C32H29F11O6/c1-3-5-6-7-19-8-11-22(25(16-19)49-32(41,42)43)23-17-20-9-10-21(18-24(20)48-27(23)45)46-14-12-28(33,34)30(37,38)31(39,40)29(35,36)13-15-47-26(44)4-2/h4,8-11,16-18H,2-3,5-7,12-15H2,1H3 |
| InChIKey | NDMWABFAOUDFQB-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.56 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|