C33H43F5O7Si — CID 153305956
7-(3,4-difluoro-6-triethoxysilylhexoxy)-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-2-one (PubChem CID 153305956) has the molecular formula C33H43F5O7Si and a molecular weight of 674.78 g/mol. Its IUPAC name is 7-(3,4-difluoro-6-triethoxysilylhexoxy)-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-2-one.
| Compound Name | 7-(3,4-difluoro-6-triethoxysilylhexoxy)-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 153305956 |
| Molecular Formula | C33H43F5O7Si |
| Molecular Weight | 674.78 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | 7-(3,4-difluoro-6-triethoxysilylhexoxy)-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-2-one |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCCC(F)C(F)CC[Si](OCC)(OCC)OCC)cc3oc2=O)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C33H43F5O7Si/c1-5-9-10-11-23-12-15-26(31(20-23)45-33(36,37)38)27-21-24-13-14-25(22-30(24)44-32(27)39)40-18-16-28(34)29(35)17-19-46(41-6-2,42-7-3)43-8-4/h12-15,20-22,28-29H,5-11,16-19H2,1-4H3 |
| InChIKey | RDNCUDCPSOORGF-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.78 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|