C40H53F5O5S — CID 155262727
[4,4-difluoro-7-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylheptyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 155262727) has the molecular formula C40H53F5O5S and a molecular weight of 740.92 g/mol. Its IUPAC name is [4,4-difluoro-7-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylheptyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [4,4-difluoro-7-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylheptyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 155262727 |
| Molecular Formula | C40H53F5O5S |
| Molecular Weight | 740.92 g/mol |
| Exact Mass | 740.35 |
| IUPAC Name | [4,4-difluoro-7-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylheptyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(SCCCC(F)(F)CCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C)cc3oc2=O)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C40H53F5O5S/c1-9-10-11-14-27-15-18-30(33(23-27)50-40(43,44)45)31-24-28-16-17-29(25-32(28)49-34(31)46)51-22-13-20-39(41,42)19-12-21-48-35(47)38(8,37(5,6)7)26-36(2,3)4/h15-18,23-25H,9-14,19-22,26H2,1-8H3 |
| InChIKey | IEBHDMFFTLUXBP-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.92 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|